Difference between revisions of "CPD0-1063"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1063 CPD0-1063] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O) |
− | ** | + | * molecular weight: |
− | ** | + | ** 345.176 |
+ | * inchi key: | ||
+ | ** InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** 2-O-(6-phospho-α-D-mannosyl)-D-glycerate |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2(α-D-mannosyl-6-phosphate)-D-glycerate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-5216]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60331 60331] |
− | {{#set: | + | * BIGG : man6pglyc |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906104 46906104] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16699 C16699] | ||
+ | * HMDB : HMDB12152 | ||
+ | {{#set: smiles=C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)}} | ||
+ | {{#set: molecular weight=345.176 }} | ||
+ | {{#set: inchi key=InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K}} | ||
+ | {{#set: common name=2-O-(6-phospho-α-D-mannosyl)-D-glycerate}} | ||
+ | {{#set: common name=2(α-D-mannosyl-6-phosphate)-D-glycerate}} | ||
+ | {{#set: consumed by=RXN0-5216}} |
Latest revision as of 16:53, 9 January 2019
Contents
Metabolite CPD0-1063
- smiles:
- C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)
- molecular weight:
- 345.176
- inchi key:
- InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K
- common name:
- 2-O-(6-phospho-α-D-mannosyl)-D-glycerate
- Synonym(s):
- 2(α-D-mannosyl-6-phosphate)-D-glycerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)" cannot be used as a page name in this wiki.