Difference between revisions of "QUINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * inchi key: ** InChIKey=AAW...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) | ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) | ||
+ | * molecular weight: | ||
+ | ** 191.16 | ||
* inchi key: | * inchi key: | ||
** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M | ** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M | ||
* common name: | * common name: | ||
** L-quinate | ** L-quinate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** (-)-quinic acid | ** (-)-quinic acid | ||
Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751] | ||
* CAS : 77-95-2 | * CAS : 77-95-2 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034] | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296] | ** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058] | ||
{{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}} | {{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}} | ||
+ | {{#set: molecular weight=191.16 }} | ||
{{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}} | {{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}} | ||
{{#set: common name=L-quinate}} | {{#set: common name=L-quinate}} | ||
− | |||
{{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}} | {{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}} | ||
{{#set: consumed by=RXN-7967}} | {{#set: consumed by=RXN-7967}} |
Latest revision as of 18:53, 9 January 2019
Contents
Metabolite QUINATE
- smiles:
- C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
- molecular weight:
- 191.16
- inchi key:
- InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
- common name:
- L-quinate
- Synonym(s):
- (-)-quinic acid
- (-)-quinate
- (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)" cannot be used as a page name in this wiki.