Difference between revisions of "PWY-5138"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11700 CPD-11700] == * smiles: ** C1(OP(=O)([O-])[O-])(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-]...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11700 CPD-11700] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138] ==
* smiles:
+
** C1(OP(=O)([O-])[O-])(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])1)
+
* inchi key:
+
** InChIKey=UPHPWXPNZIOZJL-UOTPTPDRSA-A
+
 
* common name:
 
* common name:
** 1D-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
+
** unsaturated, even numbered fatty acid β-oxidation
* molecular weight:
+
* taxonomic range:
** 726.913   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* Synonym(s):
 
* Synonym(s):
** 1-diphosinositol pentakisphosphate
+
** fatty acid β-oxidation IV (unsaturated, even number)
** iphospho-myo-inositol pentakisphosphate
+
** 1D-myo-inositol 1-diphosphate pentakisphosphate
+
** 1-diphospho-1D-myo-inositol 2,3,4,5,6-pentakisphosphate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-10974]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ENOYL-COA-HYDRAT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 5 associated gene(s):
 +
*** [[CHC_T00009110001]]
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009110001_1]]
 +
*** [[CHC_T00009190001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[OHBUTYRYL-COA-EPIM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-7836]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7699 RXN-7699]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7835 RXN-7835]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237379 44237379]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5138 PWY-5138]
* CHEBI:
+
{{#set: common name=unsaturated, even numbered fatty acid β-oxidation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74946 74946]
+
{{#set: taxonomic range=TAX-33090}}
* LIGAND-CPD:
+
{{#set: common name=fatty acid β-oxidation IV (unsaturated, even number)}}
** [http://www.genome.jp/dbget-bin/www_bget?C11174 C11174]
+
{{#set: reaction found=3}}
* HMDB : HMDB12494
+
{{#set: total reaction=5}}
{{#set: smiles=C1(OP(=O)([O-])[O-])(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])1)}}
+
{{#set: completion rate=60.0}}
{{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-UOTPTPDRSA-A}}
+
{{#set: common name=1D-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}}
+
{{#set: molecular weight=726.913    }}
+
{{#set: common name=1-diphosinositol pentakisphosphate|iphospho-myo-inositol pentakisphosphate|1D-myo-inositol 1-diphosphate pentakisphosphate|1-diphospho-1D-myo-inositol 2,3,4,5,6-pentakisphosphate}}
+
{{#set: consumed by=RXN-10974}}
+

Latest revision as of 15:44, 9 January 2019

Pathway PWY-5138

  • common name:
    • unsaturated, even numbered fatty acid β-oxidation
  • taxonomic range:
  • Synonym(s):
    • fatty acid β-oxidation IV (unsaturated, even number)

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links