Difference between revisions of "CPD-7146"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7146 CPD-7146] == * smiles: ** CC(CC1(OC(C=C(C=1)[O-])=O))C * inchi key: ** InChIKey=DFYHDD...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CC1(OC(C=C(C=1)[O-])=O))C | ** CC(CC1(OC(C=C(C=1)[O-])=O))C | ||
+ | * molecular weight: | ||
+ | ** 167.184 | ||
* inchi key: | * inchi key: | ||
** InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M | ** InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
** 6-isobutyl-4-hydroxy-2-pyrone | ** 6-isobutyl-4-hydroxy-2-pyrone | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203460 25203460] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203460 25203460] | ||
{{#set: smiles=CC(CC1(OC(C=C(C=1)[O-])=O))C}} | {{#set: smiles=CC(CC1(OC(C=C(C=1)[O-])=O))C}} | ||
+ | {{#set: molecular weight=167.184 }} | ||
{{#set: inchi key=InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M}} | {{#set: inchi key=InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M}} | ||
{{#set: common name=6-isobutyl-4-hydroxy-2-pyrone}} | {{#set: common name=6-isobutyl-4-hydroxy-2-pyrone}} | ||
− | |||
{{#set: reversible reaction associated=RXN-7825}} | {{#set: reversible reaction associated=RXN-7825}} |
Latest revision as of 19:01, 9 January 2019
Contents
Metabolite CPD-7146
- smiles:
- CC(CC1(OC(C=C(C=1)[O-])=O))C
- molecular weight:
- 167.184
- inchi key:
- InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M
- common name:
- 6-isobutyl-4-hydroxy-2-pyrone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(CC1(OC(C=C(C=1)[O-])=O))C" cannot be used as a page name in this wiki.