Difference between revisions of "PWY0-522"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-522 PWY0-522] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** lipoate salvage I |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''2''' reactions in the full pathway |
| − | + | * [[RXN-8654]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[CHC_T00006203001_1]] |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[RXN-8655]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00006203001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-522 PWY0-522] | |
| − | ** [http:// | + | {{#set: common name=lipoate salvage I}} |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-33208}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:44, 9 January 2019
Pathway PWY0-522
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- RXN-8654
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8655
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
