Difference between revisions of "7-METHYLXANTHINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-PYROPHOSPHOKINASE-RXN THIAMIN-PYROPHOSPHOKINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == |
− | * | + | * smiles: |
− | ** | + | ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) |
− | * | + | * molecular weight: |
− | ** | + | ** 166.139 |
+ | * inchi key: | ||
+ | ** InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 7-methylxanthine | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** heteroxanthine | ||
+ | ** 3,7-dihydro-7-methyl-1H-purine-2,6-dione | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11521]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48991 48991] |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68374 68374] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16353 C16353] |
− | ** [http://www. | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.61660.html 61660] | |
− | {{#set: | + | * HMDB : HMDB01991 |
− | {{#set: | + | {{#set: smiles=CN1(C=NC2(NC(=O)NC(=O)C1=2))}} |
− | {{#set: | + | {{#set: molecular weight=166.139 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N}} |
− | {{#set: | + | {{#set: common name=7-methylxanthine}} |
− | {{#set: | + | {{#set: common name=heteroxanthine|3,7-dihydro-7-methyl-1H-purine-2,6-dione}} |
+ | {{#set: consumed by=RXN-11521}} |
Latest revision as of 16:01, 9 January 2019
Contents
Metabolite 7-METHYLXANTHINE
- smiles:
- CN1(C=NC2(NC(=O)NC(=O)C1=2))
- molecular weight:
- 166.139
- inchi key:
- InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N
- common name:
- 7-methylxanthine
- Synonym(s):
- heteroxanthine
- 3,7-dihydro-7-methyl-1H-purine-2,6-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links