Difference between revisions of "CPD-9869"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C |
+ | * molecular weight: | ||
+ | ** 821.32 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N |
* common name: | * common name: | ||
− | ** | + | ** 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9235]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9234]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180] |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248] |
− | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}} | |
− | {{#set: smiles=C( | + | {{#set: molecular weight=821.32 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}} |
− | {{#set: common name= | + | {{#set: common name=2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol}} |
− | {{#set: | + | {{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}} |
− | {{#set: | + | {{#set: consumed by=RXN-9235}} |
− | {{#set: produced by= | + | {{#set: produced by=RXN-9234}} |
Latest revision as of 16:01, 9 January 2019
Contents
Metabolite CPD-9869
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
- molecular weight:
- 821.32
- inchi key:
- InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
- common name:
- 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
- Synonym(s):
- 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links