Difference between revisions of "CPD-380"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])C(=O)CS(=O)(=O)[O-] | ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] | ||
| + | * molecular weight: | ||
| + | ** 166.105 | ||
* inchi key: | * inchi key: | ||
** InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L | ** InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
** 3-sulfopyruvate | ** 3-sulfopyruvate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** sulfopyruvate | ** sulfopyruvate | ||
| Line 18: | Line 18: | ||
* [[RXN-11737]] | * [[RXN-11737]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57940 57940] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57940 57940] | ||
| Line 25: | Line 23: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245217 25245217] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245217 25245217] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05528 C05528] | ||
* HMDB : HMDB04045 | * HMDB : HMDB04045 | ||
{{#set: smiles=C(=O)([O-])C(=O)CS(=O)(=O)[O-]}} | {{#set: smiles=C(=O)([O-])C(=O)CS(=O)(=O)[O-]}} | ||
| + | {{#set: molecular weight=166.105 }} | ||
{{#set: inchi key=InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L}} | {{#set: inchi key=InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L}} | ||
{{#set: common name=3-sulfopyruvate}} | {{#set: common name=3-sulfopyruvate}} | ||
| − | |||
{{#set: common name=sulfopyruvate|3-Sulfopyruvic acid}} | {{#set: common name=sulfopyruvate|3-Sulfopyruvic acid}} | ||
{{#set: reversible reaction associated=RXN-11737}} | {{#set: reversible reaction associated=RXN-11737}} | ||
Latest revision as of 18:17, 9 January 2019
Contents
Metabolite CPD-380
- smiles:
- C(=O)([O-])C(=O)CS(=O)(=O)[O-]
- molecular weight:
- 166.105
- inchi key:
- InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L
- common name:
- 3-sulfopyruvate
- Synonym(s):
- sulfopyruvate
- 3-Sulfopyruvic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CS(=O)(=O)[O-" cannot be used as a page name in this wiki.
