Difference between revisions of "CHC T00010260001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...")
 
(Created page with "Category:Gene == Gene CHC_T00010260001_1 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-ectocarpus_siliculosus ** Source:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+
== Gene CHC_T00010260001_1 ==
* smiles:
+
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
+
* inchi key:
+
** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
+
* common name:
+
** leukotriene-D4
+
* molecular weight:
+
** 495.653   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
* [[RXN66-336]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Reaction: [[ATPSYN-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265]
+
{{#set: pathway associated=PWY-7219}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166]
+
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}}
+
{{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}}
+
{{#set: common name=leukotriene-D4}}
+
{{#set: molecular weight=495.653    }}
+
{{#set: produced by=RXN66-336}}
+

Latest revision as of 15:22, 23 May 2018

Gene CHC_T00010260001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links