Difference between revisions of "CPD-11937"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACYLAMINOACYL-PEPTIDASE-RXN ACYLAMINOACYL-PEPTIDASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec numb...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] == |
− | * | + | * smiles: |
− | ** | + | ** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1) |
− | * | + | * molecular weight: |
− | ** | + | ** 727.921 |
+ | * inchi key: | ||
+ | ** InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B | ||
+ | * common name: | ||
+ | ** 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-PP-InsP5 | ||
+ | ** 3-diphospho-1D-myo-inositol pentakisphosphate | ||
+ | ** 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10973]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10971]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173206 46173206] |
− | + | {{#set: smiles=C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)}} | |
− | + | {{#set: molecular weight=727.921 }} | |
− | + | {{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B}} | |
− | + | {{#set: common name=1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}} | |
− | + | {{#set: common name=3-PP-InsP5|3-diphospho-1D-myo-inositol pentakisphosphate|3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate}} | |
− | + | {{#set: consumed by=RXN-10973}} | |
− | + | {{#set: produced by=RXN-10971}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:57, 9 January 2019
Contents
Metabolite CPD-11937
- smiles:
- C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)
- molecular weight:
- 727.921
- inchi key:
- InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B
- common name:
- 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
- Synonym(s):
- 3-PP-InsP5
- 3-diphospho-1D-myo-inositol pentakisphosphate
- 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.