Difference between revisions of "CHC T00003275001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
(Created page with "Category:Gene == Gene CHC_T00003275001_1 == * Synonym(s): == Reactions associated == * Reaction: LYSOPHOSPHOLIPASE-RXN ** Source: orthology-ectocarpus_siliculosus...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00003275001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[LYSOPHOSPHOLIPASE-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
| − | == | + | * Reaction: [[RXN-15035]] |
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-7409]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}} | |
| − | + | {{#set: pathway associated=PWY-7409}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 14:52, 23 May 2018
Gene CHC_T00003275001_1
- Synonym(s):
Reactions associated
- Reaction: LYSOPHOSPHOLIPASE-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-15035
- Source: orthology-ectocarpus_siliculosus
