Difference between revisions of "CPD-11712"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-phosphoglucomutase Beta-phosphoglucomutase] == * common name: ** a β-phosphoglucomuta...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C | ||
+ | * molecular weight: | ||
+ | ** 396.612 | ||
+ | * inchi key: | ||
+ | ** InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol |
* Synonym(s): | * Synonym(s): | ||
+ | ** MGGBQ | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14917]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: consumed | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75411 75411] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14759579 14759579] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20737 C20737] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10470958.html 10470958] | ||
+ | {{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C}} | ||
+ | {{#set: molecular weight=396.612 }} | ||
+ | {{#set: inchi key=InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N}} | ||
+ | {{#set: common name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}} | ||
+ | {{#set: common name=MGGBQ}} | ||
+ | {{#set: consumed by=RXN-14917}} |
Latest revision as of 15:58, 9 January 2019
Contents
Metabolite CPD-11712
- smiles:
- CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C
- molecular weight:
- 396.612
- inchi key:
- InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N
- common name:
- 2-methyl-6-geranylgeranyl-1,4-benzoquinol
- Synonym(s):
- MGGBQ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links