Difference between revisions of "HOMO-SER"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009358001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * UBIQUITIN--PROTEIN-LI...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == |
| + | * smiles: | ||
| + | ** C(CO)C([N+])C([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 119.12 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N | ||
| + | * common name: | ||
| + | ** L-homoserine | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** homo-ser | ||
| + | ** homoserine | ||
| + | ** 2-amino-4-hydroxybutanoic acid | ||
| + | ** 2-amino-4-hydroxybutanoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN | + | * [[HOMSUCTRAN-RXN]] |
| − | + | * [[HOMOSERDEAM-RXN]] | |
| − | * [[ | + | * [[HOMOSERKIN-RXN]] |
| − | + | * [[RXN-14049]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[HOMOSERDEHYDROG-RXN]] |
| + | == Reaction(s) of unknown directionality == | ||
| + | * [[CYSTATHIONASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * METABOLIGHTS : MTBLC57476 |
| − | {{#set: | + | * BIGG : hom__L |
| + | * CAS : 672-15-1 | ||
| + | * HMDB : HMDB00719 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57476 57476] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00263 C00263] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971022 6971022] | ||
| + | {{#set: smiles=C(CO)C([N+])C([O-])=O}} | ||
| + | {{#set: molecular weight=119.12 }} | ||
| + | {{#set: inchi key=InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N}} | ||
| + | {{#set: common name=L-homoserine}} | ||
| + | {{#set: common name=homo-ser|homoserine|2-amino-4-hydroxybutanoic acid|2-amino-4-hydroxybutanoate}} | ||
| + | {{#set: consumed by=HOMSUCTRAN-RXN|HOMOSERDEAM-RXN|HOMOSERKIN-RXN|RXN-14049}} | ||
| + | {{#set: produced by=HOMOSERDEHYDROG-RXN}} | ||
| + | {{#set: reversible reaction associated=CYSTATHIONASE-RXN}} | ||
Latest revision as of 15:58, 9 January 2019
Contents
Metabolite HOMO-SER
- smiles:
- C(CO)C([N+])C([O-])=O
- molecular weight:
- 119.12
- inchi key:
- InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N
- common name:
- L-homoserine
- Synonym(s):
- homo-ser
- homoserine
- 2-amino-4-hydroxybutanoic acid
- 2-amino-4-hydroxybutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC57476
- BIGG : hom__L
- CAS : 672-15-1
- HMDB : HMDB00719
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(CO)C([N+])C([O-])=O" cannot be used as a page name in this wiki.
