Difference between revisions of "CPD-597"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-597 CPD-597] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(CCCNC(N)=O)[N+] |
| + | * molecular weight: | ||
| + | ** 132.185 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YANFYYGANIYHGI-UHFFFAOYSA-O |
* common name: | * common name: | ||
| − | ** | + | ** N-carbamoylputrescine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58318 58318] | ||
| + | * CAS : 6851-51-0 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244388 25244388] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00436 C00436] |
| − | * | + | * HMDB : HMDB33458 |
| − | + | {{#set: smiles=C(CCCNC(N)=O)[N+]}} | |
| − | + | {{#set: molecular weight=132.185 }} | |
| − | + | {{#set: inchi key=InChIKey=YANFYYGANIYHGI-UHFFFAOYSA-O}} | |
| − | + | {{#set: common name=N-carbamoylputrescine}} | |
| − | {{#set: smiles= | + | {{#set: consumed by=N-CARBAMOYLPUTRESCINE-AMIDASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
Latest revision as of 16:00, 9 January 2019
Contents
Metabolite CPD-597
- smiles:
- C(CCCNC(N)=O)[N+]
- molecular weight:
- 132.185
- inchi key:
- InChIKey=YANFYYGANIYHGI-UHFFFAOYSA-O
- common name:
- N-carbamoylputrescine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCCNC(N)=O)[N+" cannot be used as a page name in this wiki.
