Difference between revisions of "PWY-1042"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glycolysis IV (plant cytosol) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** glycolysis 4 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''9''' reactions found over '''10''' reactions in the full pathway |
− | * [[ | + | * [[2.7.1.90-RXN]] |
− | + | ** 2 associated gene(s): | |
− | * [[ | + | *** [[CHC_T00009387001]] |
− | + | *** [[CHC_T00007415001_1]] | |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | *** [[annotation-original_genome]] |
− | * [[ | + | * [[2PGADEHYDRAT-RXN]] |
− | * [[ | + | ** 5 associated gene(s): |
− | * [[ | + | *** [[CHC_T00008696001]] |
+ | *** [[CHC_T00008696001_1]] | ||
+ | *** [[CHC_T00009127001_1]] | ||
+ | *** [[CHC_T00008490001]] | ||
+ | *** [[CHC_T00009127001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[3PGAREARR-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00001519001_1]] | ||
+ | *** [[CHC_T00004490001_1]] | ||
+ | *** [[CHC_T00004201001_1]] | ||
+ | *** [[CHC_T00007707001_1]] | ||
+ | *** [[CHC_T00000449001_1]] | ||
+ | *** [[CHC_T00001241001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[6PFRUCTPHOS-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00009387001_1]] | ||
+ | *** [[CHC_T00008955001]] | ||
+ | *** [[CHC_T00007415001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[F16ALDOLASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008586001]] | ||
+ | *** [[CHC_T00008586001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[GAPOXNPHOSPHN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009438001_1]] | ||
+ | *** [[CHC_T00009523001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PEPDEPHOS-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00008530001]] | ||
+ | *** [[CHC_T00008652001]] | ||
+ | *** [[CHC_T00008652001_1]] | ||
+ | *** [[CHC_T00008482001_1]] | ||
+ | *** [[CHC_T00008482001]] | ||
+ | *** [[CHC_T00008530001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00004105001_1]] | ||
+ | *** [[CHC_T00009179001]] | ||
+ | *** [[CHC_T00009179001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[TRIOSEPISOMERIZATION-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[CHC_T00009126001_1]] | ||
+ | *** [[CHC_T00009523001_1]] | ||
+ | *** [[CHC_T00009126001]] | ||
+ | *** [[CHC_T00009545001]] | ||
+ | *** [[CHC_T00009545001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.9-RXN 1.2.1.9-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-1042 PWY-1042] | |
− | ** [http:// | + | {{#set: common name=glycolysis IV (plant cytosol)}} |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=glycolysis 4}} | |
− | + | {{#set: reaction found=9}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=90.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 15:50, 9 January 2019
Pathway PWY-1042
- common name:
- glycolysis IV (plant cytosol)
- taxonomic range:
- Synonym(s):
- glycolysis 4
Reaction(s) found
9 reactions found over 10 reactions in the full pathway
- 2.7.1.90-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- 2PGADEHYDRAT-RXN
- 5 associated gene(s):
- 4 reconstruction source(s) associated:
- 3PGAREARR-RXN
- 6 associated gene(s):
- 3 reconstruction source(s) associated:
- 6PFRUCTPHOS-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- F16ALDOLASE-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- GAPOXNPHOSPHN-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- PEPDEPHOS-RXN
- 6 associated gene(s):
- 4 reconstruction source(s) associated:
- PHOSGLYPHOS-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- TRIOSEPISOMERIZATION-RXN
- 5 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: