Difference between revisions of "RXN-14026"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == * smiles: ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14026 RXN-14026] ==
−
* smiles:
+
* direction:
−
** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H
+
** [http://enzyme.expasy.org/EC/3.1.3.91 EC-3.1.3.91]
−
* common name:
+
** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5]
−
** adenosyl-cobyrinate a,c-diamide
+
−
* molecular weight:
+
−
** 1182.137   
+
 
* Synonym(s):
 
* Synonym(s):
−
** adenosyl-cobyrinic acid a,c-diamide
 
−
** Adenosyl cobyrinate diamide
 
−
** Adenosylcob(III)yrinic acid a,c-diamide
 
−
** Adenosylcobyrinic acid a,c-diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[R344-RXN]]
+
** 1 [[WATER]][c] '''+''' 1 [[CMP]][c] '''=>''' 1 [[CYTIDINE]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 CMP[c] '''=>''' 1 cytidine[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008300001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00000267001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-7185]], UTP and CTP dephosphorylation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819815 91819815]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29368 29368]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58503 58503]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00511 R00511]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06506 C06506]
+
{{#set: ec number=EC-3.1.3.91}}
−
* HMDB : HMDB01083
+
{{#set: ec number=EC-3.1.3.5}}
−
{{#set: smiles=CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))}}
+
{{#set: gene associated=CHC_T00008300001_1|CHC_T00000267001_1}}
−
{{#set: inchi key=InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H}}
+
{{#set: in pathway=PWY-7185}}
−
{{#set: common name=adenosyl-cobyrinate a,c-diamide}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=1182.137    }}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
−
{{#set: common name=adenosyl-cobyrinic acid a,c-diamide|Adenosyl cobyrinate diamide|Adenosylcob(III)yrinic acid a,c-diamide|Adenosylcobyrinic acid a,c-diamide}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: produced by=R344-RXN}}
+

Latest revision as of 15:57, 9 January 2019

Reaction RXN-14026

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 CMP[c] => 1 cytidine[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7185, UTP and CTP dephosphorylation I: PWY-7185
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-14026&oldid=21037"