Difference between revisions of "CPD-12125"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9768 CPD-9768] == * smiles: ** CCCCCCCCCCCCCC=CC(=O)[O-] * inchi key: ** InChIKey=ZVRMGCSSS...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12125 CPD-12125] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C |
+ | * molecular weight: | ||
+ | ** 651.026 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=VFGNPJRRTKMYKN-LJWNYQGCSA-N |
* common name: | * common name: | ||
− | ** | + | ** menaquinol-7 |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** menaquinol(7) |
− | + | ** MKH2-7 | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9191]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64834 64834] | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447918 447918] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.394875.html 394875] |
− | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C}} | |
− | + | {{#set: molecular weight=651.026 }} | |
− | {{#set: smiles | + | {{#set: inchi key=InChIKey=VFGNPJRRTKMYKN-LJWNYQGCSA-N}} |
− | {{#set: | + | {{#set: common name=menaquinol-7}} |
− | {{#set: | + | {{#set: common name=menaquinol(7)|MKH2-7}} |
− | {{#set: | + | {{#set: produced by=RXN-9191}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 16:02, 9 January 2019
Contents
Metabolite CPD-12125
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C
- molecular weight:
- 651.026
- inchi key:
- InChIKey=VFGNPJRRTKMYKN-LJWNYQGCSA-N
- common name:
- menaquinol-7
- Synonym(s):
- menaquinol(7)
- MKH2-7
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links