Difference between revisions of "CPD-712"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3 CPD-3] == * smiles: ** [Mo](=O)(=O)([O-])[O-] * inchi key: ** InChIKey=MEFBJEMVZONFCJ-UHF...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| + | * molecular weight: | ||
| + | ** 418.702 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 6-deoxocathasterone |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** deoxocathasterone |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-773]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061344 16061344] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798] |
| − | * | + | * LIPID_MAPS : LMST01030124 |
| − | + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | |
| − | + | {{#set: molecular weight=418.702 }} | |
| − | + | {{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}} | |
| − | + | {{#set: common name=6-deoxocathasterone}} | |
| − | {{#set: smiles= | + | {{#set: common name=deoxocathasterone}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-773}} |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Latest revision as of 16:02, 9 January 2019
Contents
Metabolite CPD-712
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 418.702
- inchi key:
- InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
- common name:
- 6-deoxocathasterone
- Synonym(s):
- deoxocathasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
