Difference between revisions of "RXN-3221"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12829 CPD-12829] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(C)=CC...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12829 CPD-12829] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3221 RXN-3221] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCC1(=CC(=C(C(=C1O)C)C)O))C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=IJBLJLREWPLEPB-IQSNHBBHSA-N
+
** [http://enzyme.expasy.org/EC/5.5.1.6 EC-5.5.1.6]
−
* common name:
+
−
** plastoquinol-9
+
−
* molecular weight:
+
−
** 751.23   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-2762]]
+
** 1 [[CPD-3041]][c] '''=>''' 1 [[CPD-3061]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-11355-CPD-12321/PLASTOQUINONE-9//CPD-7535/CPD-12829.46.]]
+
** 1 isoliquiritigenin[c] '''=>''' 1 (2S)-liquiritigenin[c]
−
* [[RXN-12303-PLASTOQUINONE-9/NADH/PROTON//CPD-12829/NAD.43.]]
+
 
−
* [[RXN-12242-CPD-7526/PLASTOQUINONE-9//CPD-7496/CPD-12829.45.]]
+
== Genes associated with this reaction  ==
−
* [[1.10.99.2-RXN-CPD-7229/PLASTOQUINONE-9/PROTON//CPD-12829/NICOTINAMIDE_RIBOSE.63.]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-11237-FORMATE/PLASTOQUINONE-9/PROTON//CARBON-DIOXIDE/CPD-12829.57.]]
+
* Gene: [[CHC_T00008856001_1]]
−
* [[1.6.99.5-RXN-NADH/PLASTOQUINONE-9/PROTON//NAD/CPD-12829.43.]]
+
** Source: [[orthology-galdieria.sulphuraria]]
−
* [[RXN-12303-PLASTOQUINONE-9/NADPH/PROTON//CPD-12829/NADP.45.]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-2002]], isoflavonoid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6325]], echinatin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6325 PWY-6325]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* LIGAND-RXN:
−
** [http://www.genome.jp/dbget-bin/www_bget?C16695 C16695]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06556 R06556]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.4945177.html 4945177]
+
{{#set: ec number=EC-5.5.1.6}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00008856001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28026 28026]
+
{{#set: in pathway=PWY-2002|PWY-6325}}
−
* PUBCHEM:
+
{{#set: reconstruction category=orthology}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6440941 6440941]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCC1(=CC(=C(C(=C1O)C)C)O))C)C)C}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=IJBLJLREWPLEPB-IQSNHBBHSA-N}}
+
−
{{#set: common name=plastoquinol-9}}
+
−
{{#set: molecular weight=751.23    }}
+
−
{{#set: produced by=RXN-2762}}
+
−
{{#set: consumed or produced by=RXN-11355-CPD-12321/PLASTOQUINONE-9//CPD-7535/CPD-12829.46.|RXN-12303-PLASTOQUINONE-9/NADH/PROTON//CPD-12829/NAD.43.|RXN-12242-CPD-7526/PLASTOQUINONE-9//CPD-7496/CPD-12829.45.|1.10.99.2-RXN-CPD-7229/PLASTOQUINONE-9/PROTON//CPD-12829/NICOTINAMIDE_RIBOSE.63.|RXN-11237-FORMATE/PLASTOQUINONE-9/PROTON//CARBON-DIOXIDE/CPD-12829.57.|1.6.99.5-RXN-NADH/PLASTOQUINONE-9/PROTON//NAD/CPD-12829.43.|RXN-12303-PLASTOQUINONE-9/NADPH/PROTON//CPD-12829/NADP.45.}}
+

Latest revision as of 17:00, 9 January 2019

Reaction RXN-3221

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 isoliquiritigenin[c] => 1 (2S)-liquiritigenin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2002, isoflavonoid biosynthesis I: PWY-2002
    • 1 reactions found over 5 reactions in the full pathway
  • PWY-6325, echinatin biosynthesis: PWY-6325
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-3221&oldid=21117"