Difference between revisions of "PWY-6320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6320 PWY-6320] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phaselate biosynthesis |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** o-diphenol biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
− | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[CHC_T00008160001_1]] |
− | * [[ | + | *** [[CHC_T00008472001_1]] |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.133-RXN 2.3.1.133-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10825 RXN-10825] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2581 RXN-2581] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2621 RXN-2621] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=phaselate biosynthesis}} | |
− | + | {{#set: taxonomic range=TAX-3803}} | |
− | + | {{#set: common name=o-diphenol biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:55, 9 January 2019
Pathway PWY-6320
- common name:
- phaselate biosynthesis
- taxonomic range:
- Synonym(s):
- o-diphenol biosynthesis
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- 4-COUMARATE--COA-LIGASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: