Difference between revisions of "DGMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SS-DIMETHYL-BETA-PROPIOTHETIN SS-DIMETHYL-BETA-PROPIOTHETIN] == * smiles: ** C[S+](C)CCC(=O)[O-...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
| + | * molecular weight: | ||
| + | ** 345.208 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L |
* common name: | * common name: | ||
| − | ** | + | ** dGMP |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-dG-5'-MP |
| − | ** | + | ** 2'-deoxyguanosine 5'-monophosphate |
| − | ** | + | ** guanine riboside |
| − | ** | + | ** vernine |
| − | ** | + | ** 2'-deoxyguanosine 5'-phosphate |
| − | ** | + | ** deoxyguanosine-phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14142]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14218]] |
| + | * [[RXN0-385]] | ||
| + | * [[RXN-14208]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC57673 |
| − | * | + | * BIGG : dgmp |
| − | * | + | * CAS : 902-04-5 |
| − | + | * HMDB : HMDB01044 | |
| − | * | + | |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.5362940.html 5362940] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57673 57673] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00362 C00362] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6994968 6994968] |
| − | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} |
| − | {{#set: common name= | + | {{#set: molecular weight=345.208 }} |
| − | {{#set: produced by=RXN- | + | {{#set: inchi key=InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L}} |
| + | {{#set: common name=dGMP}} | ||
| + | {{#set: common name=2'-dG-5'-MP|2'-deoxyguanosine 5'-monophosphate|guanine riboside|vernine|2'-deoxyguanosine 5'-phosphate|deoxyguanosine-phosphate}} | ||
| + | {{#set: consumed by=RXN-14142}} | ||
| + | {{#set: produced by=RXN-14218|RXN0-385|RXN-14208}} | ||
Latest revision as of 16:06, 9 January 2019
Contents
Metabolite DGMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- molecular weight:
- 345.208
- inchi key:
- InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L
- common name:
- dGMP
- Synonym(s):
- 2'-dG-5'-MP
- 2'-deoxyguanosine 5'-monophosphate
- guanine riboside
- vernine
- 2'-deoxyguanosine 5'-phosphate
- deoxyguanosine-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC57673
- BIGG : dgmp
- CAS : 902-04-5
- HMDB : HMDB01044
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
