Difference between revisions of "RXN66-472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-472 RXN66-472] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
+
 
* common name:
 
* common name:
−
** cholest-5-en-3-one
+
** fatty aldehyde dehydrogenase
−
* molecular weight:
+
** aldehyde dehydrogenase, (NAD) activity
−
** 384.644   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12693]]
+
** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[2-Me-Branched-234-Sat-FALD]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[2-Me-Branched-234-Sat-FA]][c] '''+''' 1 [[NADH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 a 2-methyl branched 2,3,4-saturated fatty aldehyde[c] '''=>''' 2 H+[c] '''+''' 1 a 2-methyl branched 2,3,4-saturated fatty acid[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008341001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008341001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY66-387]], fatty acid α-oxidation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107]
+
{{#set: common name=fatty aldehyde dehydrogenase}}
−
* CHEBI:
+
{{#set: common name=aldehyde dehydrogenase, (NAD) activity}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906]
+
{{#set: ec number=EC-1.2.1.3}}
−
* METABOLIGHTS : MTBLC63906
+
{{#set: gene associated=CHC_T00008341001|CHC_T00008341001_1}}
−
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: in pathway=PWY66-387}}
−
{{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=cholest-5-en-3-one}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome}}
−
{{#set: molecular weight=384.644    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: produced by=RXN-12693}}
+

Latest revision as of 16:03, 9 January 2019

Reaction RXN66-472

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • fatty aldehyde dehydrogenase
    • aldehyde dehydrogenase, (NAD) activity
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-387, fatty acid α-oxidation II: PWY66-387
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN66-472&oldid=21198"