Difference between revisions of "1516-DIHYDROBILIVERDIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-form-FeS-Cluster-Scaffold-Proteins D-form-FeS-Cluster-Scaffold-Proteins] == * common name: **...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-form-FeS-Cluster-Scaffold-Proteins D-form-FeS-Cluster-Scaffold-Proteins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
 +
* smiles:
 +
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
 +
* molecular weight:
 +
** 582.655   
 +
* inchi key:
 +
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
 
* common name:
 
* common name:
** a [disordered-form [Fe-S] cluster scaffold protein]
+
** 15,16-dihydrobiliverdin
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14381]]
+
* [[1.3.7.3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14391]]
+
* [[1.3.7.2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a [disordered-form [Fe-S] cluster scaffold protein]}}
+
* CHEBI:
{{#set: consumed by=RXN-14381}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
{{#set: produced by=RXN-14391}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
 +
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
 +
{{#set: molecular weight=582.655    }}
 +
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
 +
{{#set: common name=15,16-dihydrobiliverdin}}
 +
{{#set: consumed by=1.3.7.3-RXN}}
 +
{{#set: produced by=1.3.7.2-RXN}}

Latest revision as of 17:09, 9 January 2019

Metabolite 1516-DIHYDROBILIVERDIN

  • smiles:
    • C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
  • molecular weight:
    • 582.655
  • inchi key:
    • InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
  • common name:
    • 15,16-dihydrobiliverdin
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.