Difference between revisions of "FRUCTOSE-16-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009202001 == * left end position: ** 24545 * transcription direction: ** POSITIVE * right end position: ** 25915 * centisome position: ** 37.3...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-] |
− | * | + | * molecular weight: |
− | ** | + | ** 336.085 |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J |
− | * | + | * common name: |
− | ** | + | ** fructose 1,6-bisphosphate |
* Synonym(s): | * Synonym(s): | ||
+ | ** fructose 1,6-biphosphate | ||
+ | ** fructose 1,6-diphosphate | ||
+ | ** β-D-fructose 1,6-diphosphate | ||
+ | ** D-fructose 1,6-diphosphate | ||
+ | ** D-fructos 1,6-bisphosphate | ||
+ | ** fructose 1,6-bisphosphate | ||
+ | ** FBP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[F16BDEPHOS-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[6PFRUCTPHOS-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
+ | * [[F16ALDOLASE-RXN]] | ||
+ | * [[2.7.1.90-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : fdp |
− | {{#set: | + | * CAS : 488-69-7 |
− | {{#set: | + | * HMDB : HMDB01058 |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: reaction associated= | + | ** [http://www.chemspider.com/Chemical-Structure.4574223.html 4574223] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32966 32966] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00354 C00354] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460765 5460765] | ||
+ | * Wikipedia : Fructose_1,6-bisphosphate | ||
+ | {{#set: smiles=C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]}} | ||
+ | {{#set: molecular weight=336.085 }} | ||
+ | {{#set: inchi key=InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J}} | ||
+ | {{#set: common name=fructose 1,6-bisphosphate}} | ||
+ | {{#set: common name=fructose 1,6-biphosphate|fructose 1,6-diphosphate|β-D-fructose 1,6-diphosphate|D-fructose 1,6-diphosphate|D-fructos 1,6-bisphosphate|fructose 1,6-bisphosphate|FBP}} | ||
+ | {{#set: consumed by=F16BDEPHOS-RXN}} | ||
+ | {{#set: produced by=6PFRUCTPHOS-RXN}} | ||
+ | {{#set: reversible reaction associated=F16ALDOLASE-RXN|2.7.1.90-RXN}} |
Latest revision as of 17:09, 9 January 2019
Contents
Metabolite FRUCTOSE-16-DIPHOSPHATE
- smiles:
- C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]
- molecular weight:
- 336.085
- inchi key:
- InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J
- common name:
- fructose 1,6-bisphosphate
- Synonym(s):
- fructose 1,6-biphosphate
- fructose 1,6-diphosphate
- β-D-fructose 1,6-diphosphate
- D-fructose 1,6-diphosphate
- D-fructos 1,6-bisphosphate
- fructose 1,6-bisphosphate
- FBP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : fdp
- CAS : 488-69-7
- HMDB : HMDB01058
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
- Wikipedia : Fructose_1,6-bisphosphate
"C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-" cannot be used as a page name in this wiki.