Difference between revisions of "CPD-15678"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008485001 == * left end position: ** 353278 * transcription direction: ** POSITIVE * right end position: ** 354429 * centisome position: ** 63...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * molecular weight: |
| − | ** | + | ** 943.749 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 4-trans-3-oxo-undecenoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4E-3-oxo-undecenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14793]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908] |
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: molecular weight=943.749 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}} |
| + | {{#set: common name=4-trans-3-oxo-undecenoyl-CoA}} | ||
| + | {{#set: common name=4E-3-oxo-undecenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-14793}} | ||
Latest revision as of 15:02, 9 January 2019
Contents
Metabolite CPD-15678
- smiles:
- CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 943.749
- inchi key:
- InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
- common name:
- 4-trans-3-oxo-undecenoyl-CoA
- Synonym(s):
- 4E-3-oxo-undecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
