Difference between revisions of "CPD-12116"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-462 RXN1F-462] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C |
− | * | + | * molecular weight: |
− | ** | + | ** 568.881 |
+ | * inchi key: | ||
+ | ** InChIKey=UFAXPZAZHZPELJ-ROTSUDQPSA-N | ||
+ | * common name: | ||
+ | ** demethylmenaquinol-6 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** DMKH2-6 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9220]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84539 84539] |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479495 45479495] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}} |
− | {{#set: | + | {{#set: molecular weight=568.881 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=UFAXPZAZHZPELJ-ROTSUDQPSA-N}} |
− | {{#set: | + | {{#set: common name=demethylmenaquinol-6}} |
− | {{#set: | + | {{#set: common name=DMKH2-6}} |
+ | {{#set: consumed by=RXN-9220}} |
Latest revision as of 16:11, 9 January 2019
Contents
Metabolite CPD-12116
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
- molecular weight:
- 568.881
- inchi key:
- InChIKey=UFAXPZAZHZPELJ-ROTSUDQPSA-N
- common name:
- demethylmenaquinol-6
- Synonym(s):
- DMKH2-6
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links