Difference between revisions of "CPD-1789"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.133-RXN 2.7.1.133-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.133-RXN 2.7.1.133-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)=C(O)C(=O)O1)
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.159 EC-2.7.1.159]
+
** 146.099   
 +
* inchi key:
 +
** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
 +
* common name:
 +
** dehydro-D-arabinono-1,4-lactone
 
* Synonym(s):
 
* Synonym(s):
 +
** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
 +
** D-erythro-ascorbic acid
 +
** D-erythro-ascorbate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[INOSITOL-1-3-4-TRIPHOSPHATE]][c] '''=>''' 1 [[CPD-505]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c]
+
* [[1.1.3.37-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 D-myo-inositol (1,3,4)-trisphosphate[c] '''=>''' 1 D-myo-inositol (1,3,4,6)-tetrakisphosphate[c] '''+''' 1 ADP[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00001462001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-6366]], D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6365]], D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20940 20940]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803]
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03429 R03429]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.7.1.159}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316]
−
{{#set: gene associated=CHC_T00001462001_1}}
+
{{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}}
−
{{#set: in pathway=PWY-6366|PWY-6365|PWY-6362|PWY-6554}}
+
{{#set: molecular weight=146.099    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=dehydro-D-arabinono-1,4-lactone}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}}
 +
{{#set: produced by=1.1.3.37-RXN}}

Latest revision as of 16:12, 9 January 2019

Metabolite CPD-1789

  • smiles:
    • C(O)C1(C(O)=C(O)C(=O)O1)
  • molecular weight:
    • 146.099
  • inchi key:
    • InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
  • common name:
    • dehydro-D-arabinono-1,4-lactone
  • Synonym(s):
    • (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
    • D-erythro-ascorbic acid
    • D-erythro-ascorbate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-1789&oldid=21410"