Difference between revisions of "3-HYDROXY-3-METHYL-GLUTARYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00001334001_1 == * Synonym(s): == Reactions associated == * RXN0-1081 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-3-METHYL-GLUTARYL-COA 3-HYDROXY-3-METHYL-GLUTARYL-COA] == |
+ | * smiles: | ||
+ | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(C)(O)CC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * molecular weight: | ||
+ | ** 906.621 | ||
+ | * inchi key: | ||
+ | ** InChIKey=CABVTRNMFUVUDM-VRHQGPGLSA-I | ||
+ | * common name: | ||
+ | ** (S)-3-hydroxy-3-methylglutaryl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-hydroxy-3-methyl-glutaryl-CoA | ||
+ | ** HMG-CoA | ||
+ | ** hydroxymethylglutaryl-CoA | ||
+ | ** 3-hydroxy-3-methylglutaryl-coenzyme A | ||
+ | ** 3-Hydroxy-3-methylglutaryl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
+ | * [[1.1.1.34-RXN]] | ||
+ | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: reaction associated= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43074 43074] | ||
+ | * CAS : 1553-55-5 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288565 5288565] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00356 C00356] | ||
+ | * HMDB : HMDB01375 | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(C)(O)CC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: molecular weight=906.621 }} | ||
+ | {{#set: inchi key=InChIKey=CABVTRNMFUVUDM-VRHQGPGLSA-I}} | ||
+ | {{#set: common name=(S)-3-hydroxy-3-methylglutaryl-CoA}} | ||
+ | {{#set: common name=3-hydroxy-3-methyl-glutaryl-CoA|HMG-CoA|hydroxymethylglutaryl-CoA|3-hydroxy-3-methylglutaryl-coenzyme A|3-Hydroxy-3-methylglutaryl-CoA}} | ||
+ | {{#set: consumed by=HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN}} | ||
+ | {{#set: reversible reaction associated=1.1.1.34-RXN|HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN}} |
Latest revision as of 17:14, 9 January 2019
Contents
Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(C)(O)CC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 906.621
- inchi key:
- InChIKey=CABVTRNMFUVUDM-VRHQGPGLSA-I
- common name:
- (S)-3-hydroxy-3-methylglutaryl-CoA
- Synonym(s):
- 3-hydroxy-3-methyl-glutaryl-CoA
- HMG-CoA
- hydroxymethylglutaryl-CoA
- 3-hydroxy-3-methylglutaryl-coenzyme A
- 3-Hydroxy-3-methylglutaryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(C)(O)CC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.