Difference between revisions of "CHC T00001829001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00001829001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | == | + | ** Source: [[orthology-arabidopsis_thaliana]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-1121]] | ||
+ | * [[PWY-7498]] | ||
+ | * [[PWY-7398]] | ||
+ | * [[PWY-361]] | ||
+ | * [[PWY-6039]] | ||
+ | * [[PWY-5710]] | ||
+ | * [[PWY-6792]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-1121|PWY-7498|PWY-7398|PWY-361|PWY-6039|PWY-5710|PWY-6792}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 17:03, 9 January 2019
Gene CHC_T00001829001_1
- Synonym(s):
Reactions associated
- Reaction: CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana