Difference between revisions of "CPD-8613"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13008 RXN-13008] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-[acyl-carrier-pro...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13008 RXN-13008] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
 +
* molecular weight:
 +
** 443.688   
 +
* inchi key:
 +
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
 
* common name:
 
* common name:
−
** 3-oxoacyl-[acyl-carrier-protein] reductase
+
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
−
** 3-oxoacyl-(acyl-carrier-protein) reductase
+
−
** beta-ketoacyl reductase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-18]]
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-OXO-EICOSAPENTAENOYL-ACP]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[3-HYDROXY-DOCOSAPENTAENOYL-ACP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-17]]
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a 3-oxo-docosapentaenoyl [acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxy-docosapentaenoyl-[acp][c]
+
* [[RXN-13711]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008557001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008496001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008477001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008517001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] reductase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047]
−
{{#set: common name=3-oxoacyl-(acyl-carrier-protein) reductase}}
+
* PUBCHEM:
−
{{#set: common name=beta-ketoacyl reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592]
−
{{#set: ec number=EC-2.3.1.86}}
+
* HMDB : HMDB12165
−
{{#set: ec number=EC-2.3.1.85}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: ec number=EC-1.1.1.100}}
+
{{#set: molecular weight=443.688    }}
−
{{#set: gene associated=CHC_T00008557001|CHC_T00008496001|CHC_T00008477001|CHC_T00008517001_1}}
+
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
−
{{#set: in pathway=}}
+
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN66-18}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN66-17|RXN-13711}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 16:15, 9 January 2019

Metabolite CPD-8613

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
  • molecular weight:
    • 443.688
  • inchi key:
    • InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
  • common name:
    • 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-8613&oldid=21472"