Difference between revisions of "CYCLOARTENOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] == * smiles: ** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O) * inchi key: ** In...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5)))) |
| + | * molecular weight: | ||
| + | ** 426.724 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** cycloartenol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 9β,19-cyclo-24-lanosten-3β-ol |
| − | + | ** cycloart-24(25)-enol | |
| − | + | ||
| − | + | ||
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[extended_1.14.13.72-RXN_CYCLOARTENOL]] |
| + | * [[extended_RXN66-28_CYCLOARTENOL]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CYCLOARTENOL-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030] |
| + | * CAS : 469-38-5 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902] |
| − | * | + | * HMDB : HMDB36591 |
| − | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}} | |
| − | + | {{#set: molecular weight=426.724 }} | |
| − | + | {{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}} | |
| − | + | {{#set: common name=cycloartenol}} | |
| − | {{#set: smiles= | + | {{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}} |
| − | {{#set: | + | {{#set: consumed by=extended_1.14.13.72-RXN_CYCLOARTENOL|extended_RXN66-28_CYCLOARTENOL}} |
| − | {{#set: | + | {{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
Latest revision as of 16:15, 9 January 2019
Contents
Metabolite CYCLOARTENOL
- smiles:
- CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
- molecular weight:
- 426.724
- inchi key:
- InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
- common name:
- cycloartenol
- Synonym(s):
- 9β,19-cyclo-24-lanosten-3β-ol
- cycloart-24(25)-enol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.
