Difference between revisions of "4-GUANIDO-BUTYRAMIDE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5885 PWY-5885] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(NC(N)=[N+])CCC(=O)N |
− | ** | + | * molecular weight: |
− | ** | + | ** 145.184 |
+ | * inchi key: | ||
+ | ** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** 4-guanidinobutyramide |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-guanidinobutanamide |
− | ** | + | ** 4-guanidobutanamide |
+ | ** 4-guanido-butyramide | ||
+ | ** γ-guanidinobutyramide | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[ARGININE-2-MONOOXYGENASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078] |
− | {{#set: | + | {{#set: smiles=C(NC(N)=[N+])CCC(=O)N}} |
+ | {{#set: molecular weight=145.184 }} | ||
+ | {{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}} | ||
+ | {{#set: common name=4-guanidinobutyramide}} | ||
+ | {{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}} | ||
+ | {{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}} | ||
+ | {{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}} |
Latest revision as of 17:15, 9 January 2019
Contents
Metabolite 4-GUANIDO-BUTYRAMIDE
- smiles:
- C(NC(N)=[N+])CCC(=O)N
- molecular weight:
- 145.184
- inchi key:
- InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
- common name:
- 4-guanidinobutyramide
- Synonym(s):
- 4-guanidinobutanamide
- 4-guanidobutanamide
- 4-guanido-butyramide
- γ-guanidinobutyramide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC(N)=[N+])CCC(=O)N" cannot be used as a page name in this wiki.