Difference between revisions of "RXN-17744"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17744 RXN-17744] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17744 RXN-17744] ==
−
* smiles:
+
* direction:
−
** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
+
** [http://enzyme.expasy.org/EC/1.2.1.84 EC-1.2.1.84]
−
* common name:
+
−
** tetrahydropteroyl tri-L-glutamate
+
−
* molecular weight:
+
−
** 699.633   
+
 
* Synonym(s):
 
* Synonym(s):
−
** H4PteGlu3
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12730]]
+
** 2 [[NADPH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[STEAROYL-COA]][c] '''=>''' 1 [[CPD-7873]][c] '''+''' 2 [[NADP]][c] '''+''' 1 [[CO-A]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[HOMOCYSMET-RXN]]
+
** 2 NADPH[c] '''+''' 2 H+[c] '''+''' 1 stearoyl-CoA[c] '''=>''' 1 1-octadecanol[c] '''+''' 2 NADP+[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999]
+
{{#set: ec number=EC-1.2.1.84}}
−
* CHEMSPIDER:
+
{{#set: in pathway=}}
−
** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690]
+
{{#set: reconstruction category=gap-filling}}
−
* CHEBI:
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140]
+
{{#set: reconstruction tool=meneco}}
−
* LIGAND-CPD:
+
{{#set: reconstruction comment=added for gapfilling}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144]
+
−
* HMDB : HMDB12290
+
−
{{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}}
+
−
{{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}}
+
−
{{#set: common name=tetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: molecular weight=699.633    }}
+
−
{{#set: common name=H4PteGlu3}}
+
−
{{#set: produced by=RXN-12730}}
+
−
{{#set: consumed or produced by=HOMOCYSMET-RXN}}
+

Latest revision as of 15:53, 23 May 2018

Reaction RXN-17744

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 NADPH[c] + 2 H+[c] + 1 stearoyl-CoA[c] => 1 1-octadecanol[c] + 2 NADP+[c] + 1 coenzyme A[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-17744&oldid=12470"