Difference between revisions of "CHC T00007798001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
+
== Gene CHC_T00007798001_1 ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
+
* common name:
+
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
* molecular weight:
+
** 443.688   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-18]]
+
* Reaction: [[CTPSYN-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
* [[RXN-13711]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
* [[RXN66-17]]
+
** Source: [[orthology-arabidopsis_thaliana]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[GLUTAMIN-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-14325]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways associated ==
 +
* [[PWY-7185]]
 +
* [[CITRULBIO-PWY]]
 +
* [[PWY-7177]]
 +
* [[PWY-7176]]
 +
* [[GLUTAMINDEG-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=CTPSYN-RXN|GLUTAMIN-RXN|RXN-14325}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592]
+
{{#set: pathway associated=PWY-7185|CITRULBIO-PWY|PWY-7177|PWY-7176|GLUTAMINDEG-PWY}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047]
+
* HMDB : HMDB12165
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
+
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=443.688    }}
+
{{#set: consumed by=RXN66-18}}
+
{{#set: produced by=RXN-13711|RXN66-17}}
+

Latest revision as of 17:04, 9 January 2019

Gene CHC_T00007798001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links