Difference between revisions of "2-PG"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009314001_1 == * Synonym(s): == Reactions associated == * ADENYLOSUCCINATE-SYNTHASE-RXN ** pantograph-galdieria.sulphuraria == Pa...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])C(OP(=O)([O-])[O-])CO | ||
| + | * molecular weight: | ||
| + | ** 183.034 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K | ||
| + | * common name: | ||
| + | ** 2-phospho-D-glycerate | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-phospho-(D)-glycerate | ||
| + | ** 2-phospho-(R)-glycerate | ||
| + | ** 2-phospho-D-glyceric acid | ||
| + | ** 2-P-D-glycerate | ||
| + | ** D-Glycerate 2-phosphate | ||
| + | ** D-2-phosphoglycerate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-15513]] | |
| − | * [[ | + | * [[2PGADEHYDRAT-RXN]] |
| + | * [[RXN-15510]] | ||
| + | * [[3PGAREARR-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * METABOLIGHTS : MTBLC58289 |
| − | {{#set: | + | * BIGG : 2pg |
| + | * CAS : 2553-59-5 | ||
| + | * HMDB : HMDB03391 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58289 58289] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00631 C00631] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467846 40467846] | ||
| + | {{#set: smiles=C(=O)([O-])C(OP(=O)([O-])[O-])CO}} | ||
| + | {{#set: molecular weight=183.034 }} | ||
| + | {{#set: inchi key=InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K}} | ||
| + | {{#set: common name=2-phospho-D-glycerate}} | ||
| + | {{#set: common name=2-phospho-(D)-glycerate|2-phospho-(R)-glycerate|2-phospho-D-glyceric acid|2-P-D-glycerate|D-Glycerate 2-phosphate|D-2-phosphoglycerate}} | ||
| + | {{#set: reversible reaction associated=RXN-15513|2PGADEHYDRAT-RXN|RXN-15510|3PGAREARR-RXN}} | ||
Latest revision as of 16:16, 9 January 2019
Contents
Metabolite 2-PG
- smiles:
- C(=O)([O-])C(OP(=O)([O-])[O-])CO
- molecular weight:
- 183.034
- inchi key:
- InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K
- common name:
- 2-phospho-D-glycerate
- Synonym(s):
- 2-phospho-(D)-glycerate
- 2-phospho-(R)-glycerate
- 2-phospho-D-glyceric acid
- 2-P-D-glycerate
- D-Glycerate 2-phosphate
- D-2-phosphoglycerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58289
- BIGG : 2pg
- CAS : 2553-59-5
- HMDB : HMDB03391
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(=O)([O-])C(OP(=O)([O-])[O-])CO" cannot be used as a page name in this wiki.
