Difference between revisions of "PWY-6583"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583] ==
−
* smiles:
+
−
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
−
* inchi key:
+
−
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
 
* common name:
 
* common name:
−
** cycloartenol
+
** pyruvate fermentation to butanol I
−
* molecular weight:
+
* taxonomic range:
−
** 426.724   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186801 TAX-186801]
 
* Synonym(s):
 
* Synonym(s):
−
** 9β,19-cyclo-24-lanosten-3β-ol
 
−
** cycloart-24(25)-enol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''8''' reactions in the full pathway
−
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[CHC_T00008981001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00008981001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[BUTANAL-DEHYDROGENASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[ENZRXN-201-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
** 9 associated gene(s):
 +
*** [[CHC_T00008442001_1]]
 +
*** [[CHC_T00003376001_1]]
 +
*** [[CHC_T00001730001_1]]
 +
*** [[CHC_T00001454001_1]]
 +
*** [[CHC_T00003402001_1]]
 +
*** [[CHC_T00000866001_1]]
 +
*** [[CHC_T00009061001_1]]
 +
*** [[CHC_T00008758001_1]]
 +
*** [[CHC_T00000865001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-11662]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008882001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00008557001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
* [[RXN-11667]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008882001_1]]
 +
*** [[CHC_T00009110001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
* [[RXN-161]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 469-38-5
+
{{#set: common name=pyruvate fermentation to butanol I}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-186801}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
{{#set: reaction found=7}}
−
* CHEBI:
+
{{#set: total reaction=8}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
{{#set: completion rate=88.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
−
* HMDB : HMDB36591
+
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
−
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
−
{{#set: common name=cycloartenol}}
+
−
{{#set: molecular weight=426.724    }}
+
−
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
−
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Latest revision as of 16:06, 9 January 2019

Pathway PWY-6583

  • common name:
    • pyruvate fermentation to butanol I
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

7 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-6583&oldid=21275"