Difference between revisions of "DIPHTINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE DIPHTINE] == * common name: ** a diphthine-[translation elongation factor 2] * Synonym...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE DIPHTINE] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a diphthine-[translation elongation factor 2] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 2 | + | ** a diphthine in eEF-2 |
| − | ** | + | ** a [translation elongation factor 2]-diphthine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIPHTINE--AMMONIA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14326]] | ||
| + | * [[RXN-11373]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a diphthine-[translation elongation factor 2]}} | |
| − | + | {{#set: common name=a diphthine in eEF-2|a [translation elongation factor 2]-diphthine}} | |
| − | + | {{#set: consumed by=DIPHTINE--AMMONIA-LIGASE-RXN}} | |
| − | + | {{#set: produced by=RXN-14326|RXN-11373}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 15:38, 23 May 2018
Contents
Metabolite DIPHTINE
- common name:
- a diphthine-[translation elongation factor 2]
- Synonym(s):
- a diphthine in eEF-2
- a [translation elongation factor 2]-diphthine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a diphthine-[translation elongation factor 2" cannot be used as a page name in this wiki.
"a [translation elongation factor 2]-diphthine" cannot be used as a page name in this wiki.
