Difference between revisions of "CPD-15687"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERROCYTOCHROME-B5 FERROCYTOCHROME-B5] == * common name: ** a ferrocytochrome b5 * Synonym(s):...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] == |
+ | * smiles: | ||
+ | ** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * molecular weight: | ||
+ | ** 983.813 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5Z, 7E-3-oxo-tetradecadienoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14799]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657719 90657719] |
− | {{#set: | + | {{#set: smiles=CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: molecular weight=983.813 }} |
− | {{#set: consumed | + | {{#set: inchi key=InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J}} |
+ | {{#set: common name=5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA}} | ||
+ | {{#set: common name=5Z, 7E-3-oxo-tetradecadienoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14799}} |
Latest revision as of 17:18, 9 January 2019
Contents
Metabolite CPD-15687
- smiles:
- CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 983.813
- inchi key:
- InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J
- common name:
- 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA
- Synonym(s):
- 5Z, 7E-3-oxo-tetradecadienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.