Difference between revisions of "CPD-15687"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERROCYTOCHROME-B5 FERROCYTOCHROME-B5] == * common name: ** a ferrocytochrome b5 * Synonym(s):...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERROCYTOCHROME-B5 FERROCYTOCHROME-B5] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] ==
 +
* smiles:
 +
** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 983.813   
 +
* inchi key:
 +
** InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J
 
* common name:
 
* common name:
** a ferrocytochrome b5
+
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
** a reduced cytochrome b5
+
** 5Z, 7E-3-oxo-tetradecadienoyl-CoA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11887]]
+
* [[RXN-14799]]
* [[1.14.21.6-RXN]]
+
* [[RXN-13883]]
+
* [[RXN-4209]]
+
* [[RXN-13892]]
+
* [[RXN-10664]]
+
* [[RXN3O-218]]
+
* [[RXN-16332]]
+
* [[1.14.19.1-RXN]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYTOCHROME-B5-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-16378]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a ferrocytochrome b5}}
+
* PUBCHEM:
{{#set: common name=a reduced cytochrome b5}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657719 90657719]
{{#set: consumed by=RXN-11887|1.14.21.6-RXN|RXN-13883|RXN-4209|RXN-13892|RXN-10664|RXN3O-218|RXN-16332|1.14.19.1-RXN}}
+
{{#set: smiles=CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: produced by=CYTOCHROME-B5-REDUCTASE-RXN}}
+
{{#set: molecular weight=983.813    }}
{{#set: consumed or produced by=RXN-16378}}
+
{{#set: inchi key=InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J}}
 +
{{#set: common name=5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA}}
 +
{{#set: common name=5Z, 7E-3-oxo-tetradecadienoyl-CoA}}
 +
{{#set: consumed by=RXN-14799}}

Latest revision as of 17:18, 9 January 2019

Metabolite CPD-15687

  • smiles:
    • CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 983.813
  • inchi key:
    • InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J
  • common name:
    • 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA
  • Synonym(s):
    • 5Z, 7E-3-oxo-tetradecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.