Difference between revisions of "DATP"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006214001_1 == * Synonym(s): == Reactions associated == * RIBOFLAVINSYNDEAM-RXN ** pantograph-galdieria.sulphuraria ** pantogra...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == |
| + | * smiles: | ||
| + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 487.152 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J | ||
| + | * common name: | ||
| + | ** dATP | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2'-deoxyATP | ||
| + | ** 2'-deoxyadenosine triphosphate | ||
| + | ** deoxy-ATP | ||
| + | ** deoxyadenosine-triphosphate | ||
| + | ** 2'-deoxyadenosine-5'-triphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14214]] |
| − | + | * [[RXN0-384]] | |
| − | + | * [[RXN-14195]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[DADPKIN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[RXN-14192]] |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * METABOLIGHTS : MTBLC61404 |
| − | {{#set: | + | * BIGG : datp |
| + | * CAS : 1927-31-7 | ||
| + | * HMDB : HMDB01532 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61404 61404] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00131 C00131] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25320183 25320183] | ||
| + | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}} | ||
| + | {{#set: molecular weight=487.152 }} | ||
| + | {{#set: inchi key=InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J}} | ||
| + | {{#set: common name=dATP}} | ||
| + | {{#set: common name=2'-deoxyATP|2'-deoxyadenosine triphosphate|deoxy-ATP|deoxyadenosine-triphosphate|2'-deoxyadenosine-5'-triphosphate}} | ||
| + | {{#set: consumed by=RXN-14214|RXN0-384|RXN-14195}} | ||
| + | {{#set: produced by=DADPKIN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-14192}} | ||
Latest revision as of 17:19, 9 January 2019
Contents
Metabolite DATP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
- molecular weight:
- 487.152
- inchi key:
- InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J
- common name:
- dATP
- Synonym(s):
- 2'-deoxyATP
- 2'-deoxyadenosine triphosphate
- deoxy-ATP
- deoxyadenosine-triphosphate
- 2'-deoxyadenosine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC61404
- BIGG : datp
- CAS : 1927-31-7
- HMDB : HMDB01532
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
