Difference between revisions of "PWY-3641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] ==
* smiles:
+
** C1(=CC(=O)OC(=CC(=O)[O-])1)
+
* inchi key:
+
** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
+
 
* common name:
 
* common name:
** trans-dienelactone
+
** L-carnitine degradation III
* molecular weight:
+
* taxonomic range:
** 139.087   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* Synonym(s):
 
* Synonym(s):
** 2-trans-dienelactone
 
** trans-4-carboxymethylenebut-2-en-1,4-olide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-9868]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.39-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[CHC_T00009563001_1]]
 +
*** [[CHC_T00008878001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-6002]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008341001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5921 RXN-5921]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=L-carnitine degradation III}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248]
+
{{#set: taxonomic range=TAX-1224}}
* CHEMSPIDER:
+
{{#set: reaction found=2}}
** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189]
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=67.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838]
+
{{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}}
+
{{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}}
+
{{#set: common name=trans-dienelactone}}
+
{{#set: molecular weight=139.087    }}
+
{{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}}
+
{{#set: consumed by=RXN-9868}}
+

Latest revision as of 16:09, 9 January 2019

Pathway PWY-3641

  • common name:
    • L-carnitine degradation III
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links