Difference between revisions of "PWY-6471"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] == * smiles: ** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6471 PWY-6471] ==
* smiles:
+
** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J
+
 
* common name:
 
* common name:
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA
+
** peptidoglycan biosynthesis IV (Enterococcus faecium)
* molecular weight:
+
* taxonomic range:
** 983.813   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186826 TAX-186826]
 
* Synonym(s):
 
* Synonym(s):
** 5Z, 7E-3-oxo-tetradecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14799]]
+
'''3''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PWY-6386]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[RXN-8975]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00007237001_1]]
 +
*** [[CHC_T00006227001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-8976]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009362001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6461 PWY-6461]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6461 PWY-6461]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11339 RXN-11339]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11350 RXN-11350]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11351 RXN-11351]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15521 RXN-15521]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=peptidoglycan biosynthesis IV (Enterococcus faecium)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657719 90657719]
+
{{#set: taxonomic range=TAX-186826}}
{{#set: smiles=CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=3}}
{{#set: inchi key=InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J}}
+
{{#set: total reaction=10}}
{{#set: common name=5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA}}
+
{{#set: completion rate=30.0}}
{{#set: molecular weight=983.813    }}
+
{{#set: common name=5Z, 7E-3-oxo-tetradecadienoyl-CoA}}
+
{{#set: consumed by=RXN-14799}}
+

Latest revision as of 16:09, 9 January 2019

Pathway PWY-6471

  • common name:
    • peptidoglycan biosynthesis IV (Enterococcus faecium)
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

3 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links