Difference between revisions of "PWY-7046"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7046 PWY-7046] ==
* smiles:
+
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** 4-coumarate degradation (anaerobic)
* molecular weight:
+
* taxonomic range:
** 1015.898   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-16:1-Δ7-CoA
+
** p-coumarate degradation (anaerobic)
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17781]]
+
'''2''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* [[RXN-17780]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00008160001_1]]
 +
*** [[CHC_T00008472001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-11244]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009190001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00009110001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYBENZOATE--COA-LIGASE-RXN 4-HYDROXYBENZOATE--COA-LIGASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OHBENZCOARED-RXN OHBENZCOARED-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13392 RXN-13392]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13394 RXN-13394]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=4-coumarate degradation (anaerobic)}}
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
{{#set: common name=p-coumarate degradation (anaerobic)}}
{{#set: molecular weight=1015.898    }}
+
{{#set: reaction found=2}}
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: total reaction=6}}
{{#set: consumed by=RXN-17781}}
+
{{#set: completion rate=33.0}}
{{#set: produced by=RXN-17780}}
+

Latest revision as of 16:09, 9 January 2019

Pathway PWY-7046

  • common name:
    • 4-coumarate degradation (anaerobic)
  • taxonomic range:
  • Synonym(s):
    • p-coumarate degradation (anaerobic)

Reaction(s) found

2 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links