Difference between revisions of "PWY-6035"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035] ==
* smiles:
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
+
* inchi key:
+
** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
+
 
* common name:
 
* common name:
** 5α-cholesta-8,24-dien-3-one
+
** 2,3-cis-flavanols biosynthesis
* molecular weight:
+
* taxonomic range:
** 382.628   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,3-cis-flavan-3-ols biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
* [[RXN66-318]]
+
* [[RXN-9725]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00009538001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9723 RXN-9723]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9724 RXN-9724]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=2,3-cis-flavanols biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942]
+
{{#set: taxonomic range=TAX-33090}}
* CHEBI:
+
{{#set: common name=2,3-cis-flavan-3-ols biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386]
+
{{#set: reaction found=1}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: total reaction=3}}
{{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}}
+
{{#set: completion rate=33.0}}
{{#set: common name=5α-cholesta-8,24-dien-3-one}}
+
{{#set: molecular weight=382.628    }}
+
{{#set: produced by=RXN66-318}}
+

Latest revision as of 15:02, 9 January 2019

Pathway PWY-6035

  • common name:
    • 2,3-cis-flavanols biosynthesis
  • taxonomic range:
  • Synonym(s):
    • 2,3-cis-flavan-3-ols biosynthesis

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links