Difference between revisions of "CPD-15199"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008349001_1 == * Synonym(s): == Reactions associated == * GLUTKIN-RXN ** pantograph-a.taliana * GLUTSEMIALDEHYDROG-RXN ** p...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008349001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15199 CPD-15199] ==
 +
* smiles:
 +
** CC1(OC(C(C1O)O)OP([O-])([O-])=O)
 +
* molecular weight:
 +
** 212.096   
 +
* inchi key:
 +
** InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L
 +
* common name:
 +
** 5-deoxy-α-ribose 1-phosphate
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLUTKIN-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
== Reaction(s) of unknown directionality ==
* [[GLUTSEMIALDEHYDROG-RXN]]
+
* [[RXN-14304]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
** [[pantograph]]-[[a.taliana]]
+
== Pathways associated ==
+
* [[PWY-6922]]
+
* [[PROSYN-PWY]]
+
* [[PWY-3341]]
+
* [[ARGININE-SYN4-PWY]]
+
* [[CITRULBIO-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GLUTKIN-RXN|GLUTSEMIALDEHYDROG-RXN}}
+
* CHEBI:
{{#set: pathway associated=PWY-6922|PROSYN-PWY|PWY-3341|ARGININE-SYN4-PWY|CITRULBIO-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58749 58749]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351655 51351655]
 +
{{#set: smiles=CC1(OC(C(C1O)O)OP([O-])([O-])=O)}}
 +
{{#set: molecular weight=212.096    }}
 +
{{#set: inchi key=InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L}}
 +
{{#set: common name=5-deoxy-α-ribose 1-phosphate}}
 +
{{#set: reversible reaction associated=RXN-14304}}

Latest revision as of 16:20, 9 January 2019

Metabolite CPD-15199

  • smiles:
    • CC1(OC(C(C1O)O)OP([O-])([O-])=O)
  • molecular weight:
    • 212.096
  • inchi key:
    • InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L
  • common name:
    • 5-deoxy-α-ribose 1-phosphate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(OC(C(C1O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.