Difference between revisions of "CPD-14646"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C |
− | ** | + | * molecular weight: |
+ | ** 536.882 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 9-cis-β-carotene |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-13641]] | |
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67188 67188] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9828626 9828626] |
− | {{#set: reaction | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20484 C20484] | ||
+ | {{#set: smiles=CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C}} | ||
+ | {{#set: molecular weight=536.882 }} | ||
+ | {{#set: inchi key=InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N}} | ||
+ | {{#set: common name=9-cis-β-carotene}} | ||
+ | {{#set: reversible reaction associated=RXN-13641}} |
Latest revision as of 16:20, 9 January 2019
Contents
Metabolite CPD-14646
- smiles:
- CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C
- molecular weight:
- 536.882
- inchi key:
- InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N
- common name:
- 9-cis-β-carotene
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links