Difference between revisions of "Cis-Delta5-dodecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4143 CPD-4143] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-Delta5-dodecenoyl-ACPs Cis-Delta5-dodecenoyl-ACPs] == * common name: ** a (5Z)-dodec-5-enoy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4143 CPD-4143] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-Delta5-dodecenoyl-ACPs Cis-Delta5-dodecenoyl-ACPs] ==
* smiles:
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=KZJWDPNRJALLNS-VJSFXXLFSA-N
+
 
* common name:
 
* common name:
** sitosterol
+
** a (5Z)-dodec-5-enoyl-[acp]
* molecular weight:
+
** 414.713   
+
 
* Synonym(s):
 
* Synonym(s):
** β-sitosterol
+
** a cis-Δ5-dodecenoyl-[acp]
** quebrachol
+
** cinchol
+
** cupreol
+
** rhamnol
+
** 22,23-dihydrostigmasterol
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12789]]
+
* [[RXN-10654]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-2145]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01040129
+
{{#set: common name=a (5Z)-dodec-5-enoyl-[acp]}}
* PUBCHEM:
+
{{#set: common name=a cis-Δ5-dodecenoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=222284 222284]
+
{{#set: consumed by=RXN-10654}}
* HMDB : HMDB00852
+
{{#set: produced by=RXN0-2145}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01753 C01753]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.192962.html 192962]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27693 27693]
+
* METABOLIGHTS : MTBLC27693
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=KZJWDPNRJALLNS-VJSFXXLFSA-N}}
+
{{#set: common name=sitosterol}}
+
{{#set: molecular weight=414.713    }}
+
{{#set: common name=β-sitosterol|quebrachol|cinchol|cupreol|rhamnol|22,23-dihydrostigmasterol}}
+
{{#set: consumed by=RXN-12789}}
+

Latest revision as of 15:41, 23 May 2018

Metabolite Cis-Delta5-dodecenoyl-ACPs

  • common name:
    • a (5Z)-dodec-5-enoyl-[acp]
  • Synonym(s):
    • a cis-Δ5-dodecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (5Z)-dodec-5-enoyl-[acp" cannot be used as a page name in this wiki.
"a cis-Δ5-dodecenoyl-[acp" cannot be used as a page name in this wiki.