Difference between revisions of "Methylated-Ribosomal-Protein-L11s"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15199 CPD-15199] == * smiles: ** CC1(OC(C(C1O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] == * common name: ** a met...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a methylated ribosomal protein L11 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-5419]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a methylated ribosomal protein L11}} | |
| − | + | {{#set: produced by=RXN0-5419}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 15:41, 23 May 2018
Contents
Metabolite Methylated-Ribosomal-Protein-L11s
- common name:
- a methylated ribosomal protein L11
- Synonym(s):
