Difference between revisions of "PWY-7779"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7779 PWY-7779] ==
* smiles:
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
+
* inchi key:
+
** InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N
+
 
* common name:
 
* common name:
** demethylmenaquinol-9
+
** methyl tert-butyl ether degradation
* molecular weight:
+
* taxonomic range:
** 773.236   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** DMKH2-9
+
** MTBE degradation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-9205]]
+
'''2''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[CHC_T00008981001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00008981001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-11662]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008882001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00008557001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17602 RXN-17602]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17603 RXN-17603]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17605 RXN-17605]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17606 RXN-17606]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17610 RXN-17610]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17612 RXN-17612]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17613 RXN-17613]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17615 RXN-17615]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=methyl tert-butyl ether degradation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479709 45479709]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=MTBE degradation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84542 84542]
+
{{#set: reaction found=2}}
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}}
+
{{#set: total reaction=10}}
{{#set: inchi key=InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N}}
+
{{#set: completion rate=20.0}}
{{#set: common name=demethylmenaquinol-9}}
+
{{#set: molecular weight=773.236    }}
+
{{#set: common name=DMKH2-9}}
+
{{#set: consumed by=RXN-9205}}
+

Latest revision as of 16:11, 9 January 2019

Pathway PWY-7779

  • common name:
    • methyl tert-butyl ether degradation
  • taxonomic range:
  • Synonym(s):
    • MTBE degradation

Reaction(s) found

2 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links