Difference between revisions of "CPD-19161"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12789 RXN-12789] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * molecular weight: |
| − | ** | + | ** 969.83 |
| + | * inchi key: | ||
| + | ** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J | ||
| + | * common name: | ||
| + | ** (2E,7Z)-tetradecenoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 14:2-Δ2,Δ7-CoA | ||
| + | ** 2-trans,7-cis-tetradecenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-17793]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17792]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: molecular weight=969.83 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}} |
| − | {{#set: | + | {{#set: common name=(2E,7Z)-tetradecenoyl-CoA}} |
| − | {{#set: | + | {{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17793}} |
| − | {{#set: | + | {{#set: produced by=RXN-17792}} |
Latest revision as of 16:23, 9 January 2019
Contents
Metabolite CPD-19161
- smiles:
- CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 969.83
- inchi key:
- InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
- common name:
- (2E,7Z)-tetradecenoyl-CoA
- Synonym(s):
- 14:2-Δ2,Δ7-CoA
- 2-trans,7-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
