Difference between revisions of "PWY-5971"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == * smiles: ** CC...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] ==
* smiles:
+
** CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)
+
* inchi key:
+
** InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L
+
 
* common name:
 
* common name:
** 2-C-methyl-D-erythritol-2,4-cyclodiphosphate
+
** palmitate biosynthesis II (bacteria and plants)
* molecular weight:
+
* taxonomic range:
** 276.076   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** ME-2,4cPP
+
** palmitic acid biosynthesis
 +
** de novo lipogenesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN0-882]]
+
'''31''' reactions found over '''31''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[3.1.2.21-RXN]]
* [[RXN0-302]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[4.2.1.58-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009190001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[4.2.1.59-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[4.2.1.61-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-16393]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00009428001]]
 +
*** [[CHC_T00008500001_1]]
 +
*** [[CHC_T00008811001_1]]
 +
*** [[CHC_T00008811001]]
 +
*** [[CHC_T00009428001_1]]
 +
*** [[CHC_T00008160001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9514]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008477001]]
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008517001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9516]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9518]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9520]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9523]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001]]
 +
*** [[CHC_T00009465001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9524]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9527]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001]]
 +
*** [[CHC_T00009465001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9528]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008477001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008557001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9531]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9532]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9533]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9535]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001]]
 +
*** [[CHC_T00009465001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9536]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9537]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9539]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001]]
 +
*** [[CHC_T00009465001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9540]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9549]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9623]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00009428001]]
 +
*** [[CHC_T00008811001_1]]
 +
*** [[CHC_T00008811001]]
 +
*** [[CHC_T00008500001_1]]
 +
*** [[CHC_T00008160001_1]]
 +
*** [[CHC_T00009428001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9655]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9657]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9658]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9659]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9660]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9661]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9662]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9663]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21605869 21605869]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5971 PWY-5971]
* CHEMSPIDER:
+
{{#set: common name=palmitate biosynthesis II (bacteria and plants)}}
** [http://www.chemspider.com/Chemical-Structure.10241147.html 10241147]
+
{{#set: taxonomic range=TAX-33090}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58483 58483]
+
{{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}}
* BIGG : 2mecdp
+
{{#set: reaction found=31}}
* LIGAND-CPD:
+
{{#set: total reaction=31}}
** [http://www.genome.jp/dbget-bin/www_bget?C11453 C11453]
+
{{#set: completion rate=100.0}}
{{#set: smiles=CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)}}
+
{{#set: inchi key=InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L}}
+
{{#set: common name=2-C-methyl-D-erythritol-2,4-cyclodiphosphate}}
+
{{#set: molecular weight=276.076    }}
+
{{#set: common name=ME-2,4cPP}}
+
{{#set: consumed by=RXN0-882}}
+
{{#set: produced by=RXN0-302}}
+

Latest revision as of 16:13, 9 January 2019

Pathway PWY-5971

  • common name:
    • palmitate biosynthesis II (bacteria and plants)
  • taxonomic range:
  • Synonym(s):
    • palmitic acid biosynthesis
    • de novo lipogenesis

Reaction(s) found

31 reactions found over 31 reactions in the full pathway

Reaction(s) not found

External links